C11H16N2 — CID 135207833
2-[(4Z)-hexa-1,4-dien-3-ylidene]-N,N'-dimethylpropane-1,3-diimine (PubChem CID 135207833) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-[(4Z)-hexa-1,4-dien-3-ylidene]-N,N'-dimethylpropane-1,3-diimine.
| Compound Name | 2-[(4Z)-hexa-1,4-dien-3-ylidene]-N,N'-dimethylpropane-1,3-diimine |
|---|---|
| PubChem CID | 135207833 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-[(4Z)-hexa-1,4-dien-3-ylidene]-N,N'-dimethylpropane-1,3-diimine |
| SMILES | C=CC(/C=C\C)=C(/C=N/C)/C=N/C |
| InChI | InChI=1S/C11H16N2/c1-5-7-10(6-2)11(8-12-3)9-13-4/h5-9H,2H2,1,3-4H3/b7-5-,12-8+,13-9+ |
| InChIKey | ZDQKZIPAOZGBQV-NODAKIKZSA-N |
| XLogP | 2.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|