C24H37F2N3O — CID 135209016
2-(2,4-difluorophenyl)-1-[di(hexan-2-yl)amino]-3-pyrazol-1-ylpropan-2-ol (PubChem CID 135209016) has the molecular formula C24H37F2N3O and a molecular weight of 421.58 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[di(hexan-2-yl)amino]-3-pyrazol-1-ylpropan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[di(hexan-2-yl)amino]-3-pyrazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 135209016 |
| Molecular Formula | C24H37F2N3O |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.29 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[di(hexan-2-yl)amino]-3-pyrazol-1-ylpropan-2-ol |
| SMILES | CCCCC(C)N(CC(O)(Cn1cccn1)c1ccc(F)cc1F)C(C)CCCC |
| InChI | InChI=1S/C24H37F2N3O/c1-5-7-10-19(3)29(20(4)11-8-6-2)18-24(30,17-28-15-9-14-27-28)22-13-12-21(25)16-23(22)26/h9,12-16,19-20,30H,5-8,10-11,17-18H2,1-4H3 |
| InChIKey | NLCVTSQCBBQOFX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |