C23H35F2N3O2 — CID 135209006
2-(2,4-difluorophenyl)-1-(1-pentan-2-yloxyhexylamino)-3-pyrazol-1-ylpropan-2-ol (PubChem CID 135209006) has the molecular formula C23H35F2N3O2 and a molecular weight of 423.55 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(1-pentan-2-yloxyhexylamino)-3-pyrazol-1-ylpropan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-(1-pentan-2-yloxyhexylamino)-3-pyrazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 135209006 |
| Molecular Formula | C23H35F2N3O2 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(1-pentan-2-yloxyhexylamino)-3-pyrazol-1-ylpropan-2-ol |
| SMILES | CCCCCC(NCC(O)(Cn1cccn1)c1ccc(F)cc1F)OC(C)CCC |
| InChI | InChI=1S/C23H35F2N3O2/c1-4-6-7-10-22(30-18(3)9-5-2)26-16-23(29,17-28-14-8-13-27-28)20-12-11-19(24)15-21(20)25/h8,11-15,18,22,26,29H,4-7,9-10,16-17H2,1-3H3 |
| InChIKey | KIJGVQCPOYANKN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|