C12H10N2 — CID 135210657
3-methylidene-1,2-dihydropyrrolo[3,4-b]quinoline (PubChem CID 135210657) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 3-methylidene-1,2-dihydropyrrolo[3,4-b]quinoline.
| Compound Name | 3-methylidene-1,2-dihydropyrrolo[3,4-b]quinoline |
|---|---|
| PubChem CID | 135210657 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 3-methylidene-1,2-dihydropyrrolo[3,4-b]quinoline |
| SMILES | C=C1NCc2cc3ccccc3nc21 |
| InChI | InChI=1S/C12H10N2/c1-8-12-10(7-13-8)6-9-4-2-3-5-11(9)14-12/h2-6,13H,1,7H2 |
| InChIKey | DTPXPFLTVCUXIS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |