C16H14N2 — CID 87973944
1,2,3,4-tetrahydropyrido[3,4-b]acridine (PubChem CID 87973944) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1,2,3,4-tetrahydropyrido[3,4-b]acridine.
| Compound Name | 1,2,3,4-tetrahydropyrido[3,4-b]acridine |
|---|---|
| PubChem CID | 87973944 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1,2,3,4-tetrahydropyrido[3,4-b]acridine |
| SMILES | c1ccc2nc3cc4c(cc3cc2c1)CNCC4 |
| InChI | InChI=1S/C16H14N2/c1-2-4-15-12(3-1)7-13-8-14-10-17-6-5-11(14)9-16(13)18-15/h1-4,7-9,17H,5-6,10H2 |
| InChIKey | SYUYVFKOJRKYCQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|