C20H29N3O2S — CID 135218573
tert-butyl N-[(2E,4E)-4-[(3-amino-5-ethyl-2-pyridinyl)sulfanylmethyl]hepta-2,4,6-trien-2-yl]carbamate (PubChem CID 135218573) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is tert-butyl N-[(2E,4E)-4-[(3-amino-5-ethyl-2-pyridinyl)sulfanylmethyl]hepta-2,4,6-trien-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2E,4E)-4-[(3-amino-5-ethyl-2-pyridinyl)sulfanylmethyl]hepta-2,4,6-trien-2-yl]carbamate |
|---|---|
| PubChem CID | 135218573 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | tert-butyl N-[(2E,4E)-4-[(3-amino-5-ethyl-2-pyridinyl)sulfanylmethyl]hepta-2,4,6-trien-2-yl]carbamate |
| SMILES | C=C/C=C(\C=C(/C)NC(=O)OC(C)(C)C)CSc1ncc(CC)cc1N |
| InChI | InChI=1S/C20H29N3O2S/c1-7-9-16(10-14(3)23-19(24)25-20(4,5)6)13-26-18-17(21)11-15(8-2)12-22-18/h7,9-12H,1,8,13,21H2,2-6H3,(H,23,24)/b14-10+,16-9+ |
| InChIKey | LQMQVPVPFHJJCZ-KWHSPZGRSA-N |
| XLogP | 4.86 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|