C5H6INS — CID 135219656
5-ethyl-3-iodo-1,2-thiazole (PubChem CID 135219656) has the molecular formula C5H6INS and a molecular weight of 239.08 g/mol. Its IUPAC name is 5-ethyl-3-iodo-1,2-thiazole.
| Compound Name | 5-ethyl-3-iodo-1,2-thiazole |
|---|---|
| PubChem CID | 135219656 |
| Molecular Formula | C5H6INS |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 238.93 |
| IUPAC Name | 5-ethyl-3-iodo-1,2-thiazole |
| SMILES | CCc1cc(I)ns1 |
| InChI | InChI=1S/C5H6INS/c1-2-4-3-5(6)7-8-4/h3H,2H2,1H3 |
| InChIKey | MNDQOTMLSCLLTM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|