C5H6FNS — CID 144946160
3-ethyl-5-fluoro-1,2-thiazole (PubChem CID 144946160) has the molecular formula C5H6FNS and a molecular weight of 131.17 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-1,2-thiazole.
| Compound Name | 3-ethyl-5-fluoro-1,2-thiazole |
|---|---|
| PubChem CID | 144946160 |
| Molecular Formula | C5H6FNS |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.02 |
| IUPAC Name | 3-ethyl-5-fluoro-1,2-thiazole |
| SMILES | CCc1cc(F)sn1 |
| InChI | InChI=1S/C5H6FNS/c1-2-4-3-5(6)8-7-4/h3H,2H2,1H3 |
| InChIKey | HZXGMJWGOPZACK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |