C20H20N4O2S — CID 135231359
1-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfanyl)phenyl]-3-(1,3-oxazol-5-ylmethyl)urea (PubChem CID 135231359) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfanyl)phenyl]-3-(1,3-oxazol-5-ylmethyl)urea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfanyl)phenyl]-3-(1,3-oxazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 135231359 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfanyl)phenyl]-3-(1,3-oxazol-5-ylmethyl)urea |
| SMILES | O=C(NCc1cnco1)Nc1ccc(SN2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C20H20N4O2S/c25-20(22-12-18-11-21-14-26-18)23-17-5-7-19(8-6-17)27-24-10-9-15-3-1-2-4-16(15)13-24/h1-8,11,14H,9-10,12-13H2,(H2,22,23,25) |
| InChIKey | WXPNGGHWCDMCEV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|