C17H13F2N3O2S — CID 135231588
1-[4-(3,4-difluorophenyl)sulfanylphenyl]-3-(1,3-oxazol-5-ylmethyl)urea (PubChem CID 135231588) has the molecular formula C17H13F2N3O2S and a molecular weight of 361.37 g/mol. Its IUPAC name is 1-[4-(3,4-difluorophenyl)sulfanylphenyl]-3-(1,3-oxazol-5-ylmethyl)urea.
| Compound Name | 1-[4-(3,4-difluorophenyl)sulfanylphenyl]-3-(1,3-oxazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 135231588 |
| Molecular Formula | C17H13F2N3O2S |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 1-[4-(3,4-difluorophenyl)sulfanylphenyl]-3-(1,3-oxazol-5-ylmethyl)urea |
| SMILES | O=C(NCc1cnco1)Nc1ccc(Sc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H13F2N3O2S/c18-15-6-5-14(7-16(15)19)25-13-3-1-11(2-4-13)22-17(23)21-9-12-8-20-10-24-12/h1-8,10H,9H2,(H2,21,22,23) |
| InChIKey | UYDUGSNMAILQFY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |