C16H15NO3 — CID 135242356
8-methoxy-3-phenyl-2,4-dihydro-1,3-benzoxazine-6-carbaldehyde (PubChem CID 135242356) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 8-methoxy-3-phenyl-2,4-dihydro-1,3-benzoxazine-6-carbaldehyde.
| Compound Name | 8-methoxy-3-phenyl-2,4-dihydro-1,3-benzoxazine-6-carbaldehyde |
|---|---|
| PubChem CID | 135242356 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 8-methoxy-3-phenyl-2,4-dihydro-1,3-benzoxazine-6-carbaldehyde |
| SMILES | COc1cc(C=O)cc2c1OCN(c1ccccc1)C2 |
| InChI | InChI=1S/C16H15NO3/c1-19-15-8-12(10-18)7-13-9-17(11-20-16(13)15)14-5-3-2-4-6-14/h2-8,10H,9,11H2,1H3 |
| InChIKey | PBTPYUYAVUKLMH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|