C25H23NO4 — CID 25002585
7-(3,4-dimethoxyphenyl)-3-phenyl-4,8-dihydro-2H-pyrano[3,2-g][1,3]benzoxazine (PubChem CID 25002585) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-3-phenyl-4,8-dihydro-2H-pyrano[3,2-g][1,3]benzoxazine.
| Compound Name | 7-(3,4-dimethoxyphenyl)-3-phenyl-4,8-dihydro-2H-pyrano[3,2-g][1,3]benzoxazine |
|---|---|
| PubChem CID | 25002585 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-3-phenyl-4,8-dihydro-2H-pyrano[3,2-g][1,3]benzoxazine |
| SMILES | COc1ccc(C2=Cc3cc4c(cc3OC2)OCN(c2ccccc2)C4)cc1OC |
| InChI | InChI=1S/C25H23NO4/c1-27-22-9-8-17(12-25(22)28-2)20-11-18-10-19-14-26(21-6-4-3-5-7-21)16-30-24(19)13-23(18)29-15-20/h3-13H,14-16H2,1-2H3 |
| InChIKey | MSLDIOBWRCACTJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|