C8H11N3O2S — CID 135243336
4-amino-2-(ethenylamino)benzenesulfonamide (PubChem CID 135243336) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 4-amino-2-(ethenylamino)benzenesulfonamide.
| Compound Name | 4-amino-2-(ethenylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 135243336 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 4-amino-2-(ethenylamino)benzenesulfonamide |
| SMILES | C=CNc1cc(N)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C8H11N3O2S/c1-2-11-7-5-6(9)3-4-8(7)14(10,12)13/h2-5,11H,1,9H2,(H2,10,12,13) |
| InChIKey | IJVGMPFVAIETJV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|