C37H44O2 — CID 135247884
5-[4-[4-(hydroxymethyl)pent-4-enyl]-7-(6-pentylnaphthalen-2-yl)naphthalen-2-yl]-2-methylidenepentan-1-ol (PubChem CID 135247884) has the molecular formula C37H44O2 and a molecular weight of 520.76 g/mol. Its IUPAC name is 5-[4-[4-(hydroxymethyl)pent-4-enyl]-7-(6-pentylnaphthalen-2-yl)naphthalen-2-yl]-2-methylidenepentan-1-ol.
| Compound Name | 5-[4-[4-(hydroxymethyl)pent-4-enyl]-7-(6-pentylnaphthalen-2-yl)naphthalen-2-yl]-2-methylidenepentan-1-ol |
|---|---|
| PubChem CID | 135247884 |
| Molecular Formula | C37H44O2 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | 5-[4-[4-(hydroxymethyl)pent-4-enyl]-7-(6-pentylnaphthalen-2-yl)naphthalen-2-yl]-2-methylidenepentan-1-ol |
| SMILES | C=C(CO)CCCc1cc(CCCC(=C)CO)c2ccc(-c3ccc4cc(CCCCC)ccc4c3)cc2c1 |
| InChI | InChI=1S/C37H44O2/c1-4-5-6-11-29-14-15-32-23-33(17-16-31(32)20-29)34-18-19-37-35(13-8-10-28(3)26-39)21-30(22-36(37)24-34)12-7-9-27(2)25-38/h14-24,38-39H,2-13,25-26H2,1H3 |
| InChIKey | FYAUHSLTVLEBTB-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|