C14H12ClN3O2 — CID 135254851
2-[(E)-3-chloro-2-(ethylideneamino)-3-(methylideneamino)prop-2-enyl]isoindole-1,3-dione (PubChem CID 135254851) has the molecular formula C14H12ClN3O2 and a molecular weight of 289.72 g/mol. Its IUPAC name is 2-[(E)-3-chloro-2-(ethylideneamino)-3-(methylideneamino)prop-2-enyl]isoindole-1,3-dione.
| Compound Name | 2-[(E)-3-chloro-2-(ethylideneamino)-3-(methylideneamino)prop-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135254851 |
| Molecular Formula | C14H12ClN3O2 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-[(E)-3-chloro-2-(ethylideneamino)-3-(methylideneamino)prop-2-enyl]isoindole-1,3-dione |
| SMILES | C=N/C(Cl)=C(CN1C(=O)c2ccccc2C1=O)\N=C\C |
| InChI | InChI=1S/C14H12ClN3O2/c1-3-17-11(12(15)16-2)8-18-13(19)9-6-4-5-7-10(9)14(18)20/h3-7H,2,8H2,1H3/b12-11-,17-3+ |
| InChIKey | SMXWYRKSDLKUPS-GWHPIWBVSA-N |
| XLogP | 2.48 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|