C10H9F3N4O4 — CID 135258242
(2R,3R,4R,5R)-2-(hydroxymethyl)-5-(2,6,8-trifluoropurin-9-yl)oxolane-3,4-diol (PubChem CID 135258242) has the molecular formula C10H9F3N4O4 and a molecular weight of 306.20 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(hydroxymethyl)-5-(2,6,8-trifluoropurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(hydroxymethyl)-5-(2,6,8-trifluoropurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 135258242 |
| Molecular Formula | C10H9F3N4O4 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (2R,3R,4R,5R)-2-(hydroxymethyl)-5-(2,6,8-trifluoropurin-9-yl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2c(F)nc3c(F)nc(F)nc32)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H9F3N4O4/c11-6-3-7(16-9(12)15-6)17(10(13)14-3)8-5(20)4(19)2(1-18)21-8/h2,4-5,8,18-20H,1H2/t2-,4+,5-,8-/m1/s1 |
| InChIKey | RZAHTSKJMLEVRN-SAFLGMAISA-N |
| XLogP | -1.14 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |