C23H25F6NO4S — CID 135262192
1-[4-[2-[4-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropoxy)propan-2-yl]anilino]-2-oxoethyl]phenyl]ethanesulfinic acid (PubChem CID 135262192) has the molecular formula C23H25F6NO4S and a molecular weight of 525.51 g/mol. Its IUPAC name is 1-[4-[2-[4-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropoxy)propan-2-yl]anilino]-2-oxoethyl]phenyl]ethanesulfinic acid.
| Compound Name | 1-[4-[2-[4-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropoxy)propan-2-yl]anilino]-2-oxoethyl]phenyl]ethanesulfinic acid |
|---|---|
| PubChem CID | 135262192 |
| Molecular Formula | C23H25F6NO4S |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 1-[4-[2-[4-[1,1,1,3,3,3-hexafluoro-2-(2-methylpropoxy)propan-2-yl]anilino]-2-oxoethyl]phenyl]ethanesulfinic acid |
| SMILES | CC(C)COC(c1ccc(NC(=O)Cc2ccc(C(C)S(=O)O)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H25F6NO4S/c1-14(2)13-34-21(22(24,25)26,23(27,28)29)18-8-10-19(11-9-18)30-20(31)12-16-4-6-17(7-5-16)15(3)35(32)33/h4-11,14-15H,12-13H2,1-3H3,(H,30,31)(H,32,33) |
| InChIKey | OWDBWLFFZAKMOS-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|