C27H26ClF3NO3S- — CID 155299034
1-[4-[2-[3-chloro-4-[4-(2-methylpropyl)-2-(trifluoromethyl)phenyl]anilino]-2-oxoethyl]phenyl]ethanesulfinate (PubChem CID 155299034) has the molecular formula C27H26ClF3NO3S- and a molecular weight of 537.02 g/mol. Its IUPAC name is 1-[4-[2-[3-chloro-4-[4-(2-methylpropyl)-2-(trifluoromethyl)phenyl]anilino]-2-oxoethyl]phenyl]ethanesulfinate.
| Compound Name | 1-[4-[2-[3-chloro-4-[4-(2-methylpropyl)-2-(trifluoromethyl)phenyl]anilino]-2-oxoethyl]phenyl]ethanesulfinate |
|---|---|
| PubChem CID | 155299034 |
| Molecular Formula | C27H26ClF3NO3S- |
| Molecular Weight | 537.02 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 1-[4-[2-[3-chloro-4-[4-(2-methylpropyl)-2-(trifluoromethyl)phenyl]anilino]-2-oxoethyl]phenyl]ethanesulfinate |
| SMILES | CC(C)Cc1ccc(-c2ccc(NC(=O)Cc3ccc(C(C)S(=O)[O-])cc3)cc2Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H27ClF3NO3S/c1-16(2)12-19-6-10-22(24(13-19)27(29,30)31)23-11-9-21(15-25(23)28)32-26(33)14-18-4-7-20(8-5-18)17(3)36(34)35/h4-11,13,15-17H,12,14H2,1-3H3,(H,32,33)(H,34,35)/p-1 |
| InChIKey | LKZWJQDVYVSSIT-UHFFFAOYSA-M |
| XLogP | 7.35 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.02 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|