C15H26O4 — CID 135269514
(6E,10E)-12,12-dihydroperoxy-2,6-dimethyltrideca-2,6,10-triene (PubChem CID 135269514) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (6E,10E)-12,12-dihydroperoxy-2,6-dimethyltrideca-2,6,10-triene.
| Compound Name | (6E,10E)-12,12-dihydroperoxy-2,6-dimethyltrideca-2,6,10-triene |
|---|---|
| PubChem CID | 135269514 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (6E,10E)-12,12-dihydroperoxy-2,6-dimethyltrideca-2,6,10-triene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C=C/C(C)(OO)OO |
| InChI | InChI=1S/C15H26O4/c1-13(2)9-8-11-14(3)10-6-5-7-12-15(4,18-16)19-17/h7,9-10,12,16-17H,5-6,8,11H2,1-4H3/b12-7+,14-10+ |
| InChIKey | WJABRWZOHPMLEY-QUULJSPLSA-N |
| XLogP | 4.71 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|