C17H30N2 — CID 135278053
(3R,4Z,6E)-6-N,3-dimethyl-2-N-(4-methylpent-4-enyl)nona-1,4,6-triene-2,6-diamine (PubChem CID 135278053) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is (3R,4Z,6E)-6-N,3-dimethyl-2-N-(4-methylpent-4-enyl)nona-1,4,6-triene-2,6-diamine.
| Compound Name | (3R,4Z,6E)-6-N,3-dimethyl-2-N-(4-methylpent-4-enyl)nona-1,4,6-triene-2,6-diamine |
|---|---|
| PubChem CID | 135278053 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | (3R,4Z,6E)-6-N,3-dimethyl-2-N-(4-methylpent-4-enyl)nona-1,4,6-triene-2,6-diamine |
| SMILES | C=C(C)CCCNC(=C)[C@H](C)/C=C\C(=C/CC)NC |
| InChI | InChI=1S/C17H30N2/c1-7-9-17(18-6)12-11-15(4)16(5)19-13-8-10-14(2)3/h9,11-12,15,18-19H,2,5,7-8,10,13H2,1,3-4,6H3/b12-11-,17-9+/t15-/m1/s1 |
| InChIKey | BMIXYIHYMJEMAS-IGLOCGQSSA-N |
| XLogP | 4.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|