C12H23N — CID 143792641
(3E,5Z)-7-methyl-N-propan-2-ylocta-3,5-dien-4-amine (PubChem CID 143792641) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (3E,5Z)-7-methyl-N-propan-2-ylocta-3,5-dien-4-amine.
| Compound Name | (3E,5Z)-7-methyl-N-propan-2-ylocta-3,5-dien-4-amine |
|---|---|
| PubChem CID | 143792641 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (3E,5Z)-7-methyl-N-propan-2-ylocta-3,5-dien-4-amine |
| SMILES | CC/C=C(\C=C/C(C)C)NC(C)C |
| InChI | InChI=1S/C12H23N/c1-6-7-12(13-11(4)5)9-8-10(2)3/h7-11,13H,6H2,1-5H3/b9-8-,12-7+ |
| InChIKey | NPWVTJZULSYDGG-ZHCAKQDLSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|