C12H18F3N — CID 135278163
(3E,5Z)-N-but-1-en-2-yl-8,8,8-trifluoroocta-3,5-dien-4-amine (PubChem CID 135278163) has the molecular formula C12H18F3N and a molecular weight of 233.28 g/mol. Its IUPAC name is (3E,5Z)-N-but-1-en-2-yl-8,8,8-trifluoroocta-3,5-dien-4-amine.
| Compound Name | (3E,5Z)-N-but-1-en-2-yl-8,8,8-trifluoroocta-3,5-dien-4-amine |
|---|---|
| PubChem CID | 135278163 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (3E,5Z)-N-but-1-en-2-yl-8,8,8-trifluoroocta-3,5-dien-4-amine |
| SMILES | C=C(CC)NC(/C=C\CC(F)(F)F)=C/CC |
| InChI | InChI=1S/C12H18F3N/c1-4-7-11(16-10(3)5-2)8-6-9-12(13,14)15/h6-8,16H,3-5,9H2,1-2H3/b8-6-,11-7+ |
| InChIKey | YQNUGQWAJBIJIW-FAWHLJIPSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|