C12H9F2NO3S2 — CID 135283853
4-[(3,4-difluorophenyl)carbamoyl]-5-methylthiophene-2-sulfinic acid (PubChem CID 135283853) has the molecular formula C12H9F2NO3S2 and a molecular weight of 317.34 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)carbamoyl]-5-methylthiophene-2-sulfinic acid.
| Compound Name | 4-[(3,4-difluorophenyl)carbamoyl]-5-methylthiophene-2-sulfinic acid |
|---|---|
| PubChem CID | 135283853 |
| Molecular Formula | C12H9F2NO3S2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 4-[(3,4-difluorophenyl)carbamoyl]-5-methylthiophene-2-sulfinic acid |
| SMILES | Cc1sc(S(=O)O)cc1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H9F2NO3S2/c1-6-8(5-11(19-6)20(17)18)12(16)15-7-2-3-9(13)10(14)4-7/h2-5H,1H3,(H,15,16)(H,17,18) |
| InChIKey | MDQMDJNCQMEPHY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|