C16H18N6O2 — CID 135293447
1-(4-amino-5-carbamimidoyl-2-pyridinyl)-3-(3,4-dihydro-2H-chromen-3-yl)urea (PubChem CID 135293447) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-(4-amino-5-carbamimidoyl-2-pyridinyl)-3-(3,4-dihydro-2H-chromen-3-yl)urea.
| Compound Name | 1-(4-amino-5-carbamimidoyl-2-pyridinyl)-3-(3,4-dihydro-2H-chromen-3-yl)urea |
|---|---|
| PubChem CID | 135293447 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-(4-amino-5-carbamimidoyl-2-pyridinyl)-3-(3,4-dihydro-2H-chromen-3-yl)urea |
| SMILES | [H]/N=C(\N)c1cnc(NC(=O)NC2COc3ccccc3C2)cc1N |
| InChI | InChI=1S/C16H18N6O2/c17-12-6-14(20-7-11(12)15(18)19)22-16(23)21-10-5-9-3-1-2-4-13(9)24-8-10/h1-4,6-7,10H,5,8H2,(H3,18,19)(H4,17,20,21,22,23) |
| InChIKey | WLRPMZAZJNXKDZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 139.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|