C18H17F2N3OS — CID 135296628
2-[1-(3,4-difluorophenyl)sulfinylpiperidin-4-yl]-1H-benzimidazole (PubChem CID 135296628) has the molecular formula C18H17F2N3OS and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-[1-(3,4-difluorophenyl)sulfinylpiperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-(3,4-difluorophenyl)sulfinylpiperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 135296628 |
| Molecular Formula | C18H17F2N3OS |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[1-(3,4-difluorophenyl)sulfinylpiperidin-4-yl]-1H-benzimidazole |
| SMILES | O=S(c1ccc(F)c(F)c1)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C18H17F2N3OS/c19-14-6-5-13(11-15(14)20)25(24)23-9-7-12(8-10-23)18-21-16-3-1-2-4-17(16)22-18/h1-6,11-12H,7-10H2,(H,21,22) |
| InChIKey | JDASIUDTLSQUAX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |