C12H14N4O4 — CID 135300649
2-[(4-azidophenyl)methoxycarbonylamino]-2-methylpropanoic acid (PubChem CID 135300649) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 2-[(4-azidophenyl)methoxycarbonylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(4-azidophenyl)methoxycarbonylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 135300649 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-[(4-azidophenyl)methoxycarbonylamino]-2-methylpropanoic acid |
| SMILES | CC(C)(NC(=O)OCc1ccc(N=[N+]=[N-])cc1)C(=O)O |
| InChI | InChI=1S/C12H14N4O4/c1-12(2,10(17)18)14-11(19)20-7-8-3-5-9(6-4-8)15-16-13/h3-6H,7H2,1-2H3,(H,14,19)(H,17,18) |
| InChIKey | CZTLPEDIPYQJMZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|