C16H22N4O4S2 — CID 137375797
3-[(4-azidophenyl)methoxycarbonylamino]-4-(tert-butyldisulfanyl)butanoic acid (PubChem CID 137375797) has the molecular formula C16H22N4O4S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-[(4-azidophenyl)methoxycarbonylamino]-4-(tert-butyldisulfanyl)butanoic acid.
| Compound Name | 3-[(4-azidophenyl)methoxycarbonylamino]-4-(tert-butyldisulfanyl)butanoic acid |
|---|---|
| PubChem CID | 137375797 |
| Molecular Formula | C16H22N4O4S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 3-[(4-azidophenyl)methoxycarbonylamino]-4-(tert-butyldisulfanyl)butanoic acid |
| SMILES | CC(C)(C)SSCC(CC(=O)O)NC(=O)OCc1ccc(N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C16H22N4O4S2/c1-16(2,3)26-25-10-13(8-14(21)22)18-15(23)24-9-11-4-6-12(7-5-11)19-20-17/h4-7,13H,8-10H2,1-3H3,(H,18,23)(H,21,22) |
| InChIKey | IAVCWIRTZFBECK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|