C13H16N4O6S2 — CID 58185174
2-methylsulfonylsulfanylethyl 2-[(4-azidophenyl)methoxycarbonylamino]acetate (PubChem CID 58185174) has the molecular formula C13H16N4O6S2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-methylsulfonylsulfanylethyl 2-[(4-azidophenyl)methoxycarbonylamino]acetate.
| Compound Name | 2-methylsulfonylsulfanylethyl 2-[(4-azidophenyl)methoxycarbonylamino]acetate |
|---|---|
| PubChem CID | 58185174 |
| Molecular Formula | C13H16N4O6S2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-methylsulfonylsulfanylethyl 2-[(4-azidophenyl)methoxycarbonylamino]acetate |
| SMILES | CS(=O)(=O)SCCOC(=O)CNC(=O)OCc1ccc(N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C13H16N4O6S2/c1-25(20,21)24-7-6-22-12(18)8-15-13(19)23-9-10-2-4-11(5-3-10)16-17-14/h2-5H,6-9H2,1H3,(H,15,19) |
| InChIKey | ALKJQAMMANWDFJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 147.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|