About (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate
(4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate (PubChem CID 155004586) has the molecular formula C14H11FN4O2S
and a molecular weight of 318.33 g/mol. Its IUPAC name is (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate.
Molecular Properties
| Compound Name | (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate |
| PubChem CID | 155004586 |
| Molecular Formula | C14H11FN4O2S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate |
| SMILES | [N-]=[N+]=Nc1ccc(COC(=O)NSc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C14H11FN4O2S/c15-11-3-7-13(8-4-11)22-18-14(20)21-9-10-1-5-12(6-2-10)17-19-16/h1-8H,9H2,(H,18,20) |
| InChIKey | TVVVVMGEMJIYSZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate?
The IUPAC name of (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate (CID 155004586) is (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate.
What is the SMILES notation for (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate?
The canonical SMILES for (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate is [N-]=[N+]=Nc1ccc(COC(=O)NSc2ccc(F)cc2)cc1.
What is the InChIKey of (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate?
The InChIKey is TVVVVMGEMJIYSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN4O2S/c15-11-3-7-13(8-4-11)22-18-14(20)21-9-10-1-5-12(6-2-10)17-19-16/h1-8H,9H2,(H,18,20).
What are the key properties of (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate?
(4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate has a molecular weight of 318.33 g/mol, XLogP of 4.70, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-azidophenyl)methyl N-(4-fluorophenyl)sulfanylcarbamate is sourced from PubChem (CID 155004586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).