C11H12N4O5 — CID 168986605
2-[[(4-azidophenyl)methoxycarbonylamino]methoxy]acetic acid (PubChem CID 168986605) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is 2-[[(4-azidophenyl)methoxycarbonylamino]methoxy]acetic acid.
| Compound Name | 2-[[(4-azidophenyl)methoxycarbonylamino]methoxy]acetic acid |
|---|---|
| PubChem CID | 168986605 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-[[(4-azidophenyl)methoxycarbonylamino]methoxy]acetic acid |
| SMILES | [N-]=[N+]=Nc1ccc(COC(=O)NCOCC(=O)O)cc1 |
| InChI | InChI=1S/C11H12N4O5/c12-15-14-9-3-1-8(2-4-9)5-20-11(18)13-7-19-6-10(16)17/h1-4H,5-7H2,(H,13,18)(H,16,17) |
| InChIKey | JXLQTDKLUAIOMJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|