C21H45N3O3S3 — CID 135314319
4-[1-[3,5-bis[1-(3-sulfanylbutoxy)ethyl]-1,3,5-triazinan-1-yl]ethoxy]butane-2-thiol (PubChem CID 135314319) has the molecular formula C21H45N3O3S3 and a molecular weight of 483.81 g/mol. Its IUPAC name is 4-[1-[3,5-bis[1-(3-sulfanylbutoxy)ethyl]-1,3,5-triazinan-1-yl]ethoxy]butane-2-thiol.
| Compound Name | 4-[1-[3,5-bis[1-(3-sulfanylbutoxy)ethyl]-1,3,5-triazinan-1-yl]ethoxy]butane-2-thiol |
|---|---|
| PubChem CID | 135314319 |
| Molecular Formula | C21H45N3O3S3 |
| Molecular Weight | 483.81 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 4-[1-[3,5-bis[1-(3-sulfanylbutoxy)ethyl]-1,3,5-triazinan-1-yl]ethoxy]butane-2-thiol |
| SMILES | CC(S)CCOC(C)N1CN(C(C)OCCC(C)S)CN(C(C)OCCC(C)S)C1 |
| InChI | InChI=1S/C21H45N3O3S3/c1-16(28)7-10-25-19(4)22-13-23(20(5)26-11-8-17(2)29)15-24(14-22)21(6)27-12-9-18(3)30/h16-21,28-30H,7-15H2,1-6H3 |
| InChIKey | CNWSHHLGZZNHIG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|