C22H26ClFN4O — CID 135324278
N-[[(2S,4R)-4-(aminomethyl)pyrrolidin-2-yl]methyl]-6-(4-fluorophenyl)-3-methyl-1H-indole-2-carboxamide;hydron;chloride (PubChem CID 135324278) has the molecular formula C22H26ClFN4O and a molecular weight of 416.93 g/mol. Its IUPAC name is N-[[(2S,4R)-4-(aminomethyl)pyrrolidin-2-yl]methyl]-6-(4-fluorophenyl)-3-methyl-1H-indole-2-carboxamide;hydron;chloride.
| Compound Name | N-[[(2S,4R)-4-(aminomethyl)pyrrolidin-2-yl]methyl]-6-(4-fluorophenyl)-3-methyl-1H-indole-2-carboxamide;hydron;chloride |
|---|---|
| PubChem CID | 135324278 |
| Molecular Formula | C22H26ClFN4O |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[[(2S,4R)-4-(aminomethyl)pyrrolidin-2-yl]methyl]-6-(4-fluorophenyl)-3-methyl-1H-indole-2-carboxamide;hydron;chloride |
| SMILES | Cc1c(C(=O)NC[C@@H]2C[C@H](CN)CN2)[nH]c2cc(-c3ccc(F)cc3)ccc12.[Cl-].[H+] |
| InChI | InChI=1S/C22H25FN4O.ClH/c1-13-19-7-4-16(15-2-5-17(23)6-3-15)9-20(19)27-21(13)22(28)26-12-18-8-14(10-24)11-25-18;/h2-7,9,14,18,25,27H,8,10-12,24H2,1H3,(H,26,28);1H/t14-,18+;/m1./s1 |
| InChIKey | OYBROPIDWMDREN-CQZNTPMBSA-N |
| XLogP | 0.07 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|