C16H30N2O6 — CID 135345750
2-[1-(carboxymethoxy)ethyl-[2-(octanoylamino)ethyl]amino]acetic acid (PubChem CID 135345750) has the molecular formula C16H30N2O6 and a molecular weight of 346.42 g/mol. Its IUPAC name is 2-[1-(carboxymethoxy)ethyl-[2-(octanoylamino)ethyl]amino]acetic acid.
| Compound Name | 2-[1-(carboxymethoxy)ethyl-[2-(octanoylamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 135345750 |
| Molecular Formula | C16H30N2O6 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-[1-(carboxymethoxy)ethyl-[2-(octanoylamino)ethyl]amino]acetic acid |
| SMILES | CCCCCCCC(=O)NCCN(CC(=O)O)C(C)OCC(=O)O |
| InChI | InChI=1S/C16H30N2O6/c1-3-4-5-6-7-8-14(19)17-9-10-18(11-15(20)21)13(2)24-12-16(22)23/h13H,3-12H2,1-2H3,(H,17,19)(H,20,21)(H,22,23) |
| InChIKey | LHXBXYCPXZYLLJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|