C18H34N2O5 — CID 101284148
2-[1,2-dihydroxyethyl-[2-[[(E)-dodec-8-enoyl]amino]ethyl]amino]acetic acid (PubChem CID 101284148) has the molecular formula C18H34N2O5 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-[1,2-dihydroxyethyl-[2-[[(E)-dodec-8-enoyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[1,2-dihydroxyethyl-[2-[[(E)-dodec-8-enoyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 101284148 |
| Molecular Formula | C18H34N2O5 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-[1,2-dihydroxyethyl-[2-[[(E)-dodec-8-enoyl]amino]ethyl]amino]acetic acid |
| SMILES | CCC/C=C/CCCCCCC(=O)NCCN(CC(=O)O)C(O)CO |
| InChI | InChI=1S/C18H34N2O5/c1-2-3-4-5-6-7-8-9-10-11-16(22)19-12-13-20(14-18(24)25)17(23)15-21/h4-5,17,21,23H,2-3,6-15H2,1H3,(H,19,22)(H,24,25)/b5-4+ |
| InChIKey | CVUCCCAUNGOVIG-SNAWJCMRSA-N |
| XLogP | 1.50 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|