C16H30N2O5 — CID 101284128
2-[2-[[(E)-dec-5-enoyl]amino]ethyl-(1,2-dihydroxyethyl)amino]acetic acid (PubChem CID 101284128) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-[2-[[(E)-dec-5-enoyl]amino]ethyl-(1,2-dihydroxyethyl)amino]acetic acid.
| Compound Name | 2-[2-[[(E)-dec-5-enoyl]amino]ethyl-(1,2-dihydroxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 101284128 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 2-[2-[[(E)-dec-5-enoyl]amino]ethyl-(1,2-dihydroxyethyl)amino]acetic acid |
| SMILES | CCCC/C=C/CCCC(=O)NCCN(CC(=O)O)C(O)CO |
| InChI | InChI=1S/C16H30N2O5/c1-2-3-4-5-6-7-8-9-14(20)17-10-11-18(12-16(22)23)15(21)13-19/h5-6,15,19,21H,2-4,7-13H2,1H3,(H,17,20)(H,22,23)/b6-5+ |
| InChIKey | QEPPVUPJSOPEBA-AATRIKPKSA-N |
| XLogP | 0.72 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|