C15H28N2O5 — CID 101284124
2-[1,2-dihydroxyethyl-[2-(non-8-enoylamino)ethyl]amino]acetic acid (PubChem CID 101284124) has the molecular formula C15H28N2O5 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[1,2-dihydroxyethyl-[2-(non-8-enoylamino)ethyl]amino]acetic acid.
| Compound Name | 2-[1,2-dihydroxyethyl-[2-(non-8-enoylamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 101284124 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 2-[1,2-dihydroxyethyl-[2-(non-8-enoylamino)ethyl]amino]acetic acid |
| SMILES | C=CCCCCCCC(=O)NCCN(CC(=O)O)C(O)CO |
| InChI | InChI=1S/C15H28N2O5/c1-2-3-4-5-6-7-8-13(19)16-9-10-17(11-15(21)22)14(20)12-18/h2,14,18,20H,1,3-12H2,(H,16,19)(H,21,22) |
| InChIKey | XKBIEQBIDQCGAV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|