C18H37N2NaO4 — CID 174760447
sodium;2-[2-(dodecanoylamino)ethyl-ethoxyamino]acetic acid;hydride (PubChem CID 174760447) has the molecular formula C18H37N2NaO4 and a molecular weight of 368.49 g/mol. Its IUPAC name is sodium;2-[2-(dodecanoylamino)ethyl-ethoxyamino]acetic acid;hydride.
| Compound Name | sodium;2-[2-(dodecanoylamino)ethyl-ethoxyamino]acetic acid;hydride |
|---|---|
| PubChem CID | 174760447 |
| Molecular Formula | C18H37N2NaO4 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | sodium;2-[2-(dodecanoylamino)ethyl-ethoxyamino]acetic acid;hydride |
| SMILES | CCCCCCCCCCCC(=O)NCCN(CC(=O)O)OCC.[H-].[Na+] |
| InChI | InChI=1S/C18H36N2O4.Na.H/c1-3-5-6-7-8-9-10-11-12-13-17(21)19-14-15-20(24-4-2)16-18(22)23;;/h3-16H2,1-2H3,(H,19,21)(H,22,23);;/q;+1;-1 |
| InChIKey | FPHQULLLUTXPTR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|