C27H24ClFN4O5 — CID 135350110
N-[5-chloro-6-(7,8-dimethoxyquinolin-4-yl)oxy-3-pyridinyl]-N'-(4-fluorophenyl)-2,2-dimethylpropanediamide (PubChem CID 135350110) has the molecular formula C27H24ClFN4O5 and a molecular weight of 538.96 g/mol. Its IUPAC name is N-[5-chloro-6-(7,8-dimethoxyquinolin-4-yl)oxy-3-pyridinyl]-N'-(4-fluorophenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-[5-chloro-6-(7,8-dimethoxyquinolin-4-yl)oxy-3-pyridinyl]-N'-(4-fluorophenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 135350110 |
| Molecular Formula | C27H24ClFN4O5 |
| Molecular Weight | 538.96 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | N-[5-chloro-6-(7,8-dimethoxyquinolin-4-yl)oxy-3-pyridinyl]-N'-(4-fluorophenyl)-2,2-dimethylpropanediamide |
| SMILES | COc1ccc2c(Oc3ncc(NC(=O)C(C)(C)C(=O)Nc4ccc(F)cc4)cc3Cl)ccnc2c1OC |
| InChI | InChI=1S/C27H24ClFN4O5/c1-27(2,25(34)32-16-7-5-15(29)6-8-16)26(35)33-17-13-19(28)24(31-14-17)38-20-11-12-30-22-18(20)9-10-21(36-3)23(22)37-4/h5-14H,1-4H3,(H,32,34)(H,33,35) |
| InChIKey | KKAXOXAMVBNABL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.96 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|