C24H33ClN4O2S — CID 135350690
N-[(1S)-1-amino-2-cyclohexylethyl]-3-[5-(3-chlorophenyl)-4-methyl-1,3-thiazol-2-yl]-2-(propanoylamino)propanamide (PubChem CID 135350690) has the molecular formula C24H33ClN4O2S and a molecular weight of 477.07 g/mol. Its IUPAC name is N-[(1S)-1-amino-2-cyclohexylethyl]-3-[5-(3-chlorophenyl)-4-methyl-1,3-thiazol-2-yl]-2-(propanoylamino)propanamide.
| Compound Name | N-[(1S)-1-amino-2-cyclohexylethyl]-3-[5-(3-chlorophenyl)-4-methyl-1,3-thiazol-2-yl]-2-(propanoylamino)propanamide |
|---|---|
| PubChem CID | 135350690 |
| Molecular Formula | C24H33ClN4O2S |
| Molecular Weight | 477.07 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-[(1S)-1-amino-2-cyclohexylethyl]-3-[5-(3-chlorophenyl)-4-methyl-1,3-thiazol-2-yl]-2-(propanoylamino)propanamide |
| SMILES | CCC(=O)NC(Cc1nc(C)c(-c2cccc(Cl)c2)s1)C(=O)N[C@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C24H33ClN4O2S/c1-3-21(30)28-19(24(31)29-20(26)12-16-8-5-4-6-9-16)14-22-27-15(2)23(32-22)17-10-7-11-18(25)13-17/h7,10-11,13,16,19-20H,3-6,8-9,12,14,26H2,1-2H3,(H,28,30)(H,29,31)/t19?,20-/m0/s1 |
| InChIKey | LQKJULDXPHNONW-ANYOKISRSA-N |
| XLogP | 4.58 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.07 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|