C11H8F5N3O2 — CID 135352333
1-[3,5-difluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]-N-methoxymethanamine (PubChem CID 135352333) has the molecular formula C11H8F5N3O2 and a molecular weight of 309.19 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]-N-methoxymethanamine.
| Compound Name | 1-[3,5-difluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]-N-methoxymethanamine |
|---|---|
| PubChem CID | 135352333 |
| Molecular Formula | C11H8F5N3O2 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 1-[3,5-difluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]-N-methoxymethanamine |
| SMILES | CONCc1cc(F)c(-c2noc(C(F)(F)F)n2)c(F)c1 |
| InChI | InChI=1S/C11H8F5N3O2/c1-20-17-4-5-2-6(12)8(7(13)3-5)9-18-10(21-19-9)11(14,15)16/h2-3,17H,4H2,1H3 |
| InChIKey | OTDIRHNLUAMVEI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|