C16H15FN4O3S — CID 135352623
3-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-3-N-methyl-1,1-dioxo-1,2-benzothiazole-3,5-diamine (PubChem CID 135352623) has the molecular formula C16H15FN4O3S and a molecular weight of 362.39 g/mol. Its IUPAC name is 3-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-3-N-methyl-1,1-dioxo-1,2-benzothiazole-3,5-diamine.
| Compound Name | 3-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-3-N-methyl-1,1-dioxo-1,2-benzothiazole-3,5-diamine |
|---|---|
| PubChem CID | 135352623 |
| Molecular Formula | C16H15FN4O3S |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 3-N-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-3-N-methyl-1,1-dioxo-1,2-benzothiazole-3,5-diamine |
| SMILES | COc1cc(/C=N/N(C)C2=NS(=O)(=O)c3ccc(N)cc32)ccc1F |
| InChI | InChI=1S/C16H15FN4O3S/c1-21(19-9-10-3-5-13(17)14(7-10)24-2)16-12-8-11(18)4-6-15(12)25(22,23)20-16/h3-9H,18H2,1-2H3/b19-9+ |
| InChIKey | RWVIDURMCWRMIF-DJKKODMXSA-N |
| XLogP | 1.83 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|