C17H17BFN3O5S — CID 142448965
[3-[ethyl-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]amino]-1,1-dioxo-1,2-benzothiazol-6-yl]boronic acid (PubChem CID 142448965) has the molecular formula C17H17BFN3O5S and a molecular weight of 405.22 g/mol. Its IUPAC name is [3-[ethyl-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]amino]-1,1-dioxo-1,2-benzothiazol-6-yl]boronic acid.
| Compound Name | [3-[ethyl-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]amino]-1,1-dioxo-1,2-benzothiazol-6-yl]boronic acid |
|---|---|
| PubChem CID | 142448965 |
| Molecular Formula | C17H17BFN3O5S |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [3-[ethyl-[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]amino]-1,1-dioxo-1,2-benzothiazol-6-yl]boronic acid |
| SMILES | CCN(/N=C/c1ccc(F)c(OC)c1)C1=NS(=O)(=O)c2cc(B(O)O)ccc21 |
| InChI | InChI=1S/C17H17BFN3O5S/c1-3-22(20-10-11-4-7-14(19)15(8-11)27-2)17-13-6-5-12(18(23)24)9-16(13)28(25,26)21-17/h4-10,23-24H,3H2,1-2H3/b20-10+ |
| InChIKey | WDJWYFXYABMABV-KEBDBYFISA-N |
| XLogP | 0.32 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|