C16H17BN4O5 — CID 166001915
[4-[(E)-[ethyl(furo[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]boronic acid (PubChem CID 166001915) has the molecular formula C16H17BN4O5 and a molecular weight of 356.15 g/mol. Its IUPAC name is [4-[(E)-[ethyl(furo[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]boronic acid.
| Compound Name | [4-[(E)-[ethyl(furo[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]boronic acid |
|---|---|
| PubChem CID | 166001915 |
| Molecular Formula | C16H17BN4O5 |
| Molecular Weight | 356.15 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [4-[(E)-[ethyl(furo[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]boronic acid |
| SMILES | CCN(/N=C/c1ccc(OB(O)O)c(OC)c1)c1ncnc2occc12 |
| InChI | InChI=1S/C16H17BN4O5/c1-3-21(15-12-6-7-25-16(12)19-10-18-15)20-9-11-4-5-13(26-17(22)23)14(8-11)24-2/h4-10,22-23H,3H2,1-2H3/b20-9+ |
| InChIKey | RYGBHWGGGCZKJL-AWQFTUOYSA-N |
| XLogP | 1.44 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|