C21H25BN4O5 — CID 166001879
[2-methoxy-4-[(E)-[(8-methoxyquinazolin-4-yl)-(2-methylpropyl)hydrazinylidene]methyl]phenoxy]boronic acid (PubChem CID 166001879) has the molecular formula C21H25BN4O5 and a molecular weight of 424.27 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[(8-methoxyquinazolin-4-yl)-(2-methylpropyl)hydrazinylidene]methyl]phenoxy]boronic acid.
| Compound Name | [2-methoxy-4-[(E)-[(8-methoxyquinazolin-4-yl)-(2-methylpropyl)hydrazinylidene]methyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 166001879 |
| Molecular Formula | C21H25BN4O5 |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | [2-methoxy-4-[(E)-[(8-methoxyquinazolin-4-yl)-(2-methylpropyl)hydrazinylidene]methyl]phenoxy]boronic acid |
| SMILES | COc1cc(/C=N/N(CC(C)C)c2ncnc3c(OC)cccc23)ccc1OB(O)O |
| InChI | InChI=1S/C21H25BN4O5/c1-14(2)12-26(21-16-6-5-7-18(29-3)20(16)23-13-24-21)25-11-15-8-9-17(31-22(27)28)19(10-15)30-4/h5-11,13-14,27-28H,12H2,1-4H3/b25-11+ |
| InChIKey | QBOMAHVOMDWDAU-OPEKNORGSA-N |
| XLogP | 2.49 |
| TPSA | 109.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|