C22H28BN3O8S — CID 166001905
[4-[(E)-[[5-(3-hydroxypropoxy)-1,1-dioxo-1,2-benzothiazol-3-yl]-(2-methylpropyl)hydrazinylidene]methyl]-2-methoxyphenoxy]boronic acid (PubChem CID 166001905) has the molecular formula C22H28BN3O8S and a molecular weight of 505.36 g/mol. Its IUPAC name is [4-[(E)-[[5-(3-hydroxypropoxy)-1,1-dioxo-1,2-benzothiazol-3-yl]-(2-methylpropyl)hydrazinylidene]methyl]-2-methoxyphenoxy]boronic acid.
| Compound Name | [4-[(E)-[[5-(3-hydroxypropoxy)-1,1-dioxo-1,2-benzothiazol-3-yl]-(2-methylpropyl)hydrazinylidene]methyl]-2-methoxyphenoxy]boronic acid |
|---|---|
| PubChem CID | 166001905 |
| Molecular Formula | C22H28BN3O8S |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | [4-[(E)-[[5-(3-hydroxypropoxy)-1,1-dioxo-1,2-benzothiazol-3-yl]-(2-methylpropyl)hydrazinylidene]methyl]-2-methoxyphenoxy]boronic acid |
| SMILES | COc1cc(/C=N/N(CC(C)C)C2=NS(=O)(=O)c3ccc(OCCCO)cc32)ccc1OB(O)O |
| InChI | InChI=1S/C22H28BN3O8S/c1-15(2)14-26(24-13-16-5-7-19(34-23(28)29)20(11-16)32-3)22-18-12-17(33-10-4-9-27)6-8-21(18)35(30,31)25-22/h5-8,11-13,15,27-29H,4,9-10,14H2,1-3H3/b24-13+ |
| InChIKey | CSCCTLUGGGPBEI-ZMOGYAJESA-N |
| XLogP | 1.25 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|