C19H21BFN3O5S — CID 142449028
[3-[[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-(2-methylpropyl)amino]-1,1-dioxo-1,2-benzothiazol-6-yl]boronic acid (PubChem CID 142449028) has the molecular formula C19H21BFN3O5S and a molecular weight of 433.27 g/mol. Its IUPAC name is [3-[[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-(2-methylpropyl)amino]-1,1-dioxo-1,2-benzothiazol-6-yl]boronic acid.
| Compound Name | [3-[[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-(2-methylpropyl)amino]-1,1-dioxo-1,2-benzothiazol-6-yl]boronic acid |
|---|---|
| PubChem CID | 142449028 |
| Molecular Formula | C19H21BFN3O5S |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [3-[[(E)-(4-fluoro-3-methoxyphenyl)methylideneamino]-(2-methylpropyl)amino]-1,1-dioxo-1,2-benzothiazol-6-yl]boronic acid |
| SMILES | COc1cc(/C=N/N(CC(C)C)C2=NS(=O)(=O)c3cc(B(O)O)ccc32)ccc1F |
| InChI | InChI=1S/C19H21BFN3O5S/c1-12(2)11-24(22-10-13-4-7-16(21)17(8-13)29-3)19-15-6-5-14(20(25)26)9-18(15)30(27,28)23-19/h4-10,12,25-26H,11H2,1-3H3/b22-10+ |
| InChIKey | FMVYSCZHBZNIBR-LSHDLFTRSA-N |
| XLogP | 0.96 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|