C22H27BN4O6 — CID 166001904
[4-[(E)-[(6,8-dimethoxyquinazolin-4-yl)-(2-methylpropyl)hydrazinylidene]methyl]-2-methoxyphenoxy]boronic acid (PubChem CID 166001904) has the molecular formula C22H27BN4O6 and a molecular weight of 454.29 g/mol. Its IUPAC name is [4-[(E)-[(6,8-dimethoxyquinazolin-4-yl)-(2-methylpropyl)hydrazinylidene]methyl]-2-methoxyphenoxy]boronic acid.
| Compound Name | [4-[(E)-[(6,8-dimethoxyquinazolin-4-yl)-(2-methylpropyl)hydrazinylidene]methyl]-2-methoxyphenoxy]boronic acid |
|---|---|
| PubChem CID | 166001904 |
| Molecular Formula | C22H27BN4O6 |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [4-[(E)-[(6,8-dimethoxyquinazolin-4-yl)-(2-methylpropyl)hydrazinylidene]methyl]-2-methoxyphenoxy]boronic acid |
| SMILES | COc1cc(OC)c2ncnc(N(CC(C)C)/N=C/c3ccc(OB(O)O)c(OC)c3)c2c1 |
| InChI | InChI=1S/C22H27BN4O6/c1-14(2)12-27(26-11-15-6-7-18(33-23(28)29)19(8-15)31-4)22-17-9-16(30-3)10-20(32-5)21(17)24-13-25-22/h6-11,13-14,28-29H,12H2,1-5H3/b26-11+ |
| InChIKey | CGPYBBWSMLBDJW-KBKYJPHKSA-N |
| XLogP | 2.50 |
| TPSA | 118.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|