C25H20BrN3O3S — CID 135370088
2-amino-5-(4-bromophenyl)-N-phenyl-3-(4-sulfamoylphenyl)benzamide (PubChem CID 135370088) has the molecular formula C25H20BrN3O3S and a molecular weight of 522.42 g/mol. Its IUPAC name is 2-amino-5-(4-bromophenyl)-N-phenyl-3-(4-sulfamoylphenyl)benzamide.
| Compound Name | 2-amino-5-(4-bromophenyl)-N-phenyl-3-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 135370088 |
| Molecular Formula | C25H20BrN3O3S |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | 2-amino-5-(4-bromophenyl)-N-phenyl-3-(4-sulfamoylphenyl)benzamide |
| SMILES | Nc1c(C(=O)Nc2ccccc2)cc(-c2ccc(Br)cc2)cc1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C25H20BrN3O3S/c26-19-10-6-16(7-11-19)18-14-22(17-8-12-21(13-9-17)33(28,31)32)24(27)23(15-18)25(30)29-20-4-2-1-3-5-20/h1-15H,27H2,(H,29,30)(H2,28,31,32) |
| InChIKey | IEGKLOPSCHHVBF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|