C29H32N2O6 — CID 135371210
benzyl 2-[4-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-2-oxoethoxy]phenyl]benzoate (PubChem CID 135371210) has the molecular formula C29H32N2O6 and a molecular weight of 504.58 g/mol. Its IUPAC name is benzyl 2-[4-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-2-oxoethoxy]phenyl]benzoate.
| Compound Name | benzyl 2-[4-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-2-oxoethoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 135371210 |
| Molecular Formula | C29H32N2O6 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | benzyl 2-[4-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-2-oxoethoxy]phenyl]benzoate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)COc1ccc(-c2ccccc2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N2O6/c1-29(2,3)37-28(34)31-18-17-30-26(32)20-35-23-15-13-22(14-16-23)24-11-7-8-12-25(24)27(33)36-19-21-9-5-4-6-10-21/h4-16H,17-20H2,1-3H3,(H,30,32)(H,31,34) |
| InChIKey | OTHXBTONGPOBDE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|