C36H45NO7 — CID 163885007
benzyl 3-[4-[2-[3-[4-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentoxy]butylamino]-2-oxoethoxy]phenyl]benzoate (PubChem CID 163885007) has the molecular formula C36H45NO7 and a molecular weight of 603.76 g/mol. Its IUPAC name is benzyl 3-[4-[2-[3-[4-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentoxy]butylamino]-2-oxoethoxy]phenyl]benzoate.
| Compound Name | benzyl 3-[4-[2-[3-[4-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentoxy]butylamino]-2-oxoethoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 163885007 |
| Molecular Formula | C36H45NO7 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.32 |
| IUPAC Name | benzyl 3-[4-[2-[3-[4-methyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentoxy]butylamino]-2-oxoethoxy]phenyl]benzoate |
| SMILES | CC(CCNC(=O)COc1ccc(-c2cccc(C(=O)OCc3ccccc3)c2)cc1)OCCCC(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H45NO7/c1-26(34(39)44-36(3,4)5)11-10-22-41-27(2)20-21-37-33(38)25-42-32-18-16-29(17-19-32)30-14-9-15-31(23-30)35(40)43-24-28-12-7-6-8-13-28/h6-9,12-19,23,26-27H,10-11,20-22,24-25H2,1-5H3,(H,37,38) |
| InChIKey | PWOYAIAEANSKLV-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|